C23H19N3O2 — CID 2114779
(5R)-5-(1H-indol-3-ylmethyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione (PubChem CID 2114779) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (5R)-5-(1H-indol-3-ylmethyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1H-indol-3-ylmethyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2114779 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (5R)-5-(1H-indol-3-ylmethyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H19N3O2/c27-22-21(12-17-13-24-20-11-4-3-10-19(17)20)25-23(28)26(22)14-16-8-5-7-15-6-1-2-9-18(15)16/h1-11,13,21,24H,12,14H2,(H,25,28)/t21-/m1/s1 |
| InChIKey | GQTSBYIQMOAYSA-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|