C19H15N5O3S — CID 2467017
(5R)-5-(1H-indol-3-ylmethyl)-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione (PubChem CID 2467017) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is (5R)-5-(1H-indol-3-ylmethyl)-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1H-indol-3-ylmethyl)-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2467017 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (5R)-5-(1H-indol-3-ylmethyl)-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C19H15N5O3S/c25-16-8-12(21-19-23(16)5-6-28-19)10-24-17(26)15(22-18(24)27)7-11-9-20-14-4-2-1-3-13(11)14/h1-6,8-9,15,20H,7,10H2,(H,22,27)/t15-/m1/s1 |
| InChIKey | CBUDBWGFUMIABC-OAHLLOKOSA-N |
| XLogP | 1.90 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|