C17H14N4O3S — CID 51531205
(5S)-5-benzyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione (PubChem CID 51531205) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51531205 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (5S)-5-benzyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N1Cc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C17H14N4O3S/c22-14-9-12(18-17-20(14)6-7-25-17)10-21-15(23)13(19-16(21)24)8-11-4-2-1-3-5-11/h1-7,9,13H,8,10H2,(H,19,24)/t13-/m0/s1 |
| InChIKey | UWHSCFPRKVUMJJ-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|