C20H19N3O5 — CID 38828547
methyl 5-[[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]-3-methylfuran-2-carboxylate (PubChem CID 38828547) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is methyl 5-[[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]-3-methylfuran-2-carboxylate.
| Compound Name | methyl 5-[[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 38828547 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 5-[[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]-3-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1oc(CN2C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C2=O)cc1C |
| InChI | InChI=1S/C20H19N3O5/c1-11-7-13(28-17(11)19(25)27-2)10-23-18(24)16(22-20(23)26)8-12-9-21-15-6-4-3-5-14(12)15/h3-7,9,16,21H,8,10H2,1-2H3,(H,22,26)/t16-/m0/s1 |
| InChIKey | GQSMWDZKJUPBAM-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|