C18H22N4O4 — CID 51564726
2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide (PubChem CID 51564726) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 51564726 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@H](C)NC(=O)CN1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C18H22N4O4/c1-11(10-26-2)20-16(23)9-22-17(24)15(21-18(22)25)7-12-8-19-14-6-4-3-5-13(12)14/h3-6,8,11,15,19H,7,9-10H2,1-2H3,(H,20,23)(H,21,25)/t11-,15-/m0/s1 |
| InChIKey | VDZSREIBCKNJFB-NHYWBVRUSA-N |
| XLogP | 0.78 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|