C27H23ClN4O3 — CID 41103981
N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41103981) has the molecular formula C27H23ClN4O3 and a molecular weight of 486.96 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41103981 |
| Molecular Formula | C27H23ClN4O3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O)N[C@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN4O3/c28-20-12-10-18(11-13-20)25(17-6-2-1-3-7-17)31-24(33)16-32-26(34)23(30-27(32)35)14-19-15-29-22-9-5-4-8-21(19)22/h1-13,15,23,25,29H,14,16H2,(H,30,35)(H,31,33)/t23-,25+/m0/s1 |
| InChIKey | PXEGDZAHEGDVKD-UKILVPOCSA-N |
| XLogP | 4.19 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|