C20H26N4O3 — CID 47003741
2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide (PubChem CID 47003741) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 47003741 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)NC(Cc2c[nH]c3ccccc23)C1=O)C(C)C |
| InChI | InChI=1S/C20H26N4O3/c1-12(2)24(13(3)4)18(25)11-23-19(26)17(22-20(23)27)9-14-10-21-16-8-6-5-7-15(14)16/h5-8,10,12-13,17,21H,9,11H2,1-4H3,(H,22,27) |
| InChIKey | RJEOQJMVDXDWRI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|