C26H28N4O3 — CID 51556220
N-cyclohexyl-2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 51556220) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 51556220 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-cyclohexyl-2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | O=C1N[C@H](Cc2c[nH]c3ccccc23)C(=O)N1CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H28N4O3/c31-24(30(19-9-3-1-4-10-19)20-11-5-2-6-12-20)17-29-25(32)23(28-26(29)33)15-18-16-27-22-14-8-7-13-21(18)22/h1,3-4,7-10,13-14,16,20,23,27H,2,5-6,11-12,15,17H2,(H,28,33)/t23-/m1/s1 |
| InChIKey | ZGKLLSYTHWVXCL-HSZRJFAPSA-N |
| XLogP | 4.00 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|