C24H26N4O3 — CID 2462867
N-benzyl-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide (PubChem CID 2462867) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-benzyl-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | N-benzyl-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 2462867 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-benzyl-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)CN1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C24H26N4O3/c1-16(2)27(14-17-8-4-3-5-9-17)22(29)15-28-23(30)21(26-24(28)31)12-18-13-25-20-11-7-6-10-19(18)20/h3-11,13,16,21,25H,12,14-15H2,1-2H3,(H,26,31)/t21-/m0/s1 |
| InChIKey | DDGQMDJECWGOAN-NRFANRHFSA-N |
| XLogP | 3.07 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|