C19H15F2N3O2 — CID 51532327
(5S)-3-[(2,3-difluorophenyl)methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 51532327) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is (5S)-3-[(2,3-difluorophenyl)methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2,3-difluorophenyl)methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51532327 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (5S)-3-[(2,3-difluorophenyl)methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C19H15F2N3O2/c20-14-6-3-4-11(17(14)21)10-24-18(25)16(23-19(24)26)8-12-9-22-15-7-2-1-5-13(12)15/h1-7,9,16,22H,8,10H2,(H,23,26)/t16-/m0/s1 |
| InChIKey | IIFGIDZAESWXCT-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|