C20H18FN3O3 — CID 2100381
(5R)-3-[2-(4-fluorophenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 2100381) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is (5R)-3-[2-(4-fluorophenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(4-fluorophenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2100381 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (5R)-3-[2-(4-fluorophenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3ccccc23)C(=O)N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FN3O3/c21-14-5-7-15(8-6-14)27-10-9-24-19(25)18(23-20(24)26)11-13-12-22-17-4-2-1-3-16(13)17/h1-8,12,18,22H,9-11H2,(H,23,26)/t18-/m1/s1 |
| InChIKey | CRZWLCACFNDRAM-GOSISDBHSA-N |
| XLogP | 2.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|