C22H23N3O3 — CID 47006749
3-[2-(3,5-dimethylphenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 47006749) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(3,5-dimethylphenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47006749 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-[2-(3,5-dimethylphenoxy)ethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)cc(OCCN2C(=O)NC(Cc3c[nH]c4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-9-15(2)11-17(10-14)28-8-7-25-21(26)20(24-22(25)27)12-16-13-23-19-6-4-3-5-18(16)19/h3-6,9-11,13,20,23H,7-8,12H2,1-2H3,(H,24,27) |
| InChIKey | SNKCZEHKZLMEFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|