C18H17N5O3 — CID 2426481
(2R)-3-amino-2-[2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]but-3-enenitrile (PubChem CID 2426481) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is (2R)-3-amino-2-[2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]but-3-enenitrile.
| Compound Name | (2R)-3-amino-2-[2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]but-3-enenitrile |
|---|---|
| PubChem CID | 2426481 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (2R)-3-amino-2-[2-[(4R)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]but-3-enenitrile |
| SMILES | C=C(N)[C@H](C#N)C(=O)CN1C(=O)N[C@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C18H17N5O3/c1-10(20)13(7-19)16(24)9-23-17(25)15(22-18(23)26)6-11-8-21-14-5-3-2-4-12(11)14/h2-5,8,13,15,21H,1,6,9,20H2,(H,22,26)/t13-,15+/m0/s1 |
| InChIKey | GEPIESUDSYJEGH-DZGCQCFKSA-N |
| XLogP | 0.81 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|