C22H22N4O3 — CID 124906480
2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 124906480) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 124906480 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccccc2)C1=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H22N4O3/c27-20(23-11-10-16-13-24-18-9-5-4-8-17(16)18)12-19-21(28)26(22(29)25-19)14-15-6-2-1-3-7-15/h1-9,13,19,24H,10-12,14H2,(H,23,27)(H,25,29)/t19-/m1/s1 |
| InChIKey | ANQBRUNQQCADNM-LJQANCHMSA-N |
| XLogP | 2.34 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|