C22H21ClN4O3 — CID 125434004
2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]acetamide (PubChem CID 125434004) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 125434004 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[(4S)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccccc2)C1=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H21ClN4O3/c23-16-6-7-18-17(10-16)15(12-25-18)8-9-24-20(28)11-19-21(29)27(22(30)26-19)13-14-4-2-1-3-5-14/h1-7,10,12,19,25H,8-9,11,13H2,(H,24,28)(H,26,30)/t19-/m0/s1 |
| InChIKey | DRFKOKFJFPKYJF-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|