C24H23ClN4O5 — CID 29134314
3-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]propanamide (PubChem CID 29134314) has the molecular formula C24H23ClN4O5 and a molecular weight of 482.92 g/mol. Its IUPAC name is 3-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 29134314 |
| Molecular Formula | C24H23ClN4O5 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-[(4S)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-chloro-1H-indol-3-yl)ethyl]propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H23ClN4O5/c25-16-2-3-18-17(10-16)15(11-27-18)7-8-26-22(30)6-4-19-23(31)29(24(32)28-19)12-14-1-5-20-21(9-14)34-13-33-20/h1-3,5,9-11,19,27H,4,6-8,12-13H2,(H,26,30)(H,28,32)/t19-/m0/s1 |
| InChIKey | AYCQRZHVARUCQB-IBGZPJMESA-N |
| XLogP | 3.11 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|