C21H20ClN3O5 — CID 73257738
3-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide (PubChem CID 73257738) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is 3-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide.
| Compound Name | 3-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 73257738 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide |
| SMILES | O=C(CCC1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O5/c22-15-3-1-2-13(8-15)10-23-19(26)7-5-16-20(27)25(21(28)24-16)11-14-4-6-17-18(9-14)30-12-29-17/h1-4,6,8-9,16H,5,7,10-12H2,(H,23,26)(H,24,28) |
| InChIKey | LIYZPTHLALPOCS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|