C23H21ClN4O5 — CID 51837234
N-(1,3-benzodioxol-5-yl)-3-[(4R)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 51837234) has the molecular formula C23H21ClN4O5 and a molecular weight of 468.90 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[(4R)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[(4R)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 51837234 |
| Molecular Formula | C23H21ClN4O5 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[(4R)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | O=C(CC[C@H]1NC(=O)N(CCc2c[nH]c3ccc(Cl)cc23)C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H21ClN4O5/c24-14-1-3-17-16(9-14)13(11-25-17)7-8-28-22(30)18(27-23(28)31)4-6-21(29)26-15-2-5-19-20(10-15)33-12-32-19/h1-3,5,9-11,18,25H,4,6-8,12H2,(H,26,29)(H,27,31)/t18-/m1/s1 |
| InChIKey | ZTLDEXWJDPPMOJ-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|