C22H27ClN4O3 — CID 73259625
5-[3-(azepan-1-yl)-3-oxopropyl]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 73259625) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 5-[3-(azepan-1-yl)-3-oxopropyl]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-(azepan-1-yl)-3-oxopropyl]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 73259625 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-[3-(azepan-1-yl)-3-oxopropyl]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CCC1NC(=O)N(CCc2c[nH]c3ccc(Cl)cc23)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C22H27ClN4O3/c23-16-5-6-18-17(13-16)15(14-24-18)9-12-27-21(29)19(25-22(27)30)7-8-20(28)26-10-3-1-2-4-11-26/h5-6,13-14,19,24H,1-4,7-12H2,(H,25,30) |
| InChIKey | NPRLXDAMIKRDTJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|