C22H28N4O3 — CID 91823490
N-cycloheptyl-2-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 91823490) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-cycloheptyl-2-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-cycloheptyl-2-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 91823490 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-cycloheptyl-2-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | O=C(CC1NC(=O)N(CCc2c[nH]c3ccccc23)C1=O)NC1CCCCCC1 |
| InChI | InChI=1S/C22H28N4O3/c27-20(24-16-7-3-1-2-4-8-16)13-19-21(28)26(22(29)25-19)12-11-15-14-23-18-10-6-5-9-17(15)18/h5-6,9-10,14,16,19,23H,1-4,7-8,11-13H2,(H,24,27)(H,25,29) |
| InChIKey | QBCICMUQQTUDCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|