C20H24N4O4 — CID 51808572
3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-prop-2-enylpropanamide (PubChem CID 51808572) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-prop-2-enylpropanamide.
| Compound Name | 3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 51808572 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CC[C@H]1NC(=O)N(CCc2c[nH]c3ccc(OC)cc23)C1=O |
| InChI | InChI=1S/C20H24N4O4/c1-3-9-21-18(25)7-6-17-19(26)24(20(27)23-17)10-8-13-12-22-16-5-4-14(28-2)11-15(13)16/h3-5,11-12,17,22H,1,6-10H2,2H3,(H,21,25)(H,23,27)/t17-/m1/s1 |
| InChIKey | CXGFVKPFIZMNOT-QGZVFWFLSA-N |
| XLogP | 1.72 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|