C21H22N4O5 — CID 122169381
2-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 122169381) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 122169381 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CC3NC(=O)N(Cc4ccco4)C3=O)c2c1 |
| InChI | InChI=1S/C21H22N4O5/c1-29-14-4-5-17-16(9-14)13(11-23-17)6-7-22-19(26)10-18-20(27)25(21(28)24-18)12-15-3-2-8-30-15/h2-5,8-9,11,18,23H,6-7,10,12H2,1H3,(H,22,26)(H,24,28) |
| InChIKey | CAUSPMAGWCTCDH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|