C24H34N4O4 — CID 98399429
N-heptyl-3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 98399429) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-heptyl-3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-heptyl-3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 98399429 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-heptyl-3-[(4R)-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | CCCCCCCNC(=O)CC[C@H]1NC(=O)N(CCc2c[nH]c3ccc(OC)cc23)C1=O |
| InChI | InChI=1S/C24H34N4O4/c1-3-4-5-6-7-13-25-22(29)11-10-21-23(30)28(24(31)27-21)14-12-17-16-26-20-9-8-18(32-2)15-19(17)20/h8-9,15-16,21,26H,3-7,10-14H2,1-2H3,(H,25,29)(H,27,31)/t21-/m1/s1 |
| InChIKey | DDQJJZBLUMYJTN-OAQYLSRUSA-N |
| XLogP | 3.51 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|