C21H28N4O3 — CID 73257190
3-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-methylbutyl)propanamide (PubChem CID 73257190) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-methylbutyl)propanamide.
| Compound Name | 3-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 73257190 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)CCC1NC(=O)N(CCc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C21H28N4O3/c1-14(2)9-11-22-19(26)8-7-18-20(27)25(21(28)24-18)12-10-15-13-23-17-6-4-3-5-16(15)17/h3-6,13-14,18,23H,7-12H2,1-2H3,(H,22,26)(H,24,28) |
| InChIKey | MEUHSGZBAZOQMP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|