C16H18N4O3 — CID 70723639
3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 70723639) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 70723639 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | O=C(CCC1NC(=O)NC1=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N4O3/c21-14(6-5-13-15(22)20-16(23)19-13)17-8-7-10-9-18-12-4-2-1-3-11(10)12/h1-4,9,13,18H,5-8H2,(H,17,21)(H2,19,20,22,23) |
| InChIKey | GIYCPAVXJVWHRA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|