C15H19N3O4 — CID 75511825
3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 75511825) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 75511825 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccccc1CCNC(=O)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C15H19N3O4/c1-22-12-5-3-2-4-10(12)8-9-16-13(19)7-6-11-14(20)18-15(21)17-11/h2-5,11H,6-9H2,1H3,(H,16,19)(H2,17,18,20,21) |
| InChIKey | MJVSIFUKPCGITM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|