C17H24N2O3 — CID 39930096
N-[4-[2-(2-methoxyphenyl)ethylamino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 39930096) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyphenyl)ethylamino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-(2-methoxyphenyl)ethylamino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 39930096 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[4-[2-(2-methoxyphenyl)ethylamino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | COc1ccccc1CCNC(=O)CCCNC(=O)C1CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-22-15-6-3-2-5-13(15)10-12-18-16(20)7-4-11-19-17(21)14-8-9-14/h2-3,5-6,14H,4,7-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | OZMYTWJYJXDGJH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|