C18H24F2N2O4 — CID 46438041
N-[4-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 46438041) has the molecular formula C18H24F2N2O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[4-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46438041 |
| Molecular Formula | C18H24F2N2O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[4-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | COc1cc(CCNC(=O)CCCNC(=O)C2CC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H24F2N2O4/c1-25-15-11-12(4-7-14(15)26-18(19)20)8-10-21-16(23)3-2-9-22-17(24)13-5-6-13/h4,7,11,13,18H,2-3,5-6,8-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | UFXPVYCEHQPAKB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|