C22H29F2NO3S — CID 8513878
2-(1-adamantylsulfanyl)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide (PubChem CID 8513878) has the molecular formula C22H29F2NO3S and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-(1-adamantylsulfanyl)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 8513878 |
| Molecular Formula | C22H29F2NO3S |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)CSC23CC4CC(CC(C4)C2)C3)ccc1OC(F)F |
| InChI | InChI=1S/C22H29F2NO3S/c1-27-19-9-14(2-3-18(19)28-21(23)24)4-5-25-20(26)13-29-22-10-15-6-16(11-22)8-17(7-15)12-22/h2-3,9,15-17,21H,4-8,10-13H2,1H3,(H,25,26) |
| InChIKey | WLIRMZZKXRCFBT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |