C15H17FN4O4 — CID 94646293
N-[2-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoylamino]ethyl]-4-fluorobenzamide (PubChem CID 94646293) has the molecular formula C15H17FN4O4 and a molecular weight of 336.32 g/mol. Its IUPAC name is N-[2-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoylamino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoylamino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94646293 |
| Molecular Formula | C15H17FN4O4 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[2-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoylamino]ethyl]-4-fluorobenzamide |
| SMILES | O=C(CC[C@H]1NC(=O)NC1=O)NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN4O4/c16-10-3-1-9(2-4-10)13(22)18-8-7-17-12(21)6-5-11-14(23)20-15(24)19-11/h1-4,11H,5-8H2,(H,17,21)(H,18,22)(H2,19,20,23,24)/t11-/m1/s1 |
| InChIKey | QTQWHCNPJHLQGW-LLVKDONJSA-N |
| XLogP | -0.34 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|