C14H17ClN4O5S — CID 131930236
N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 131930236) has the molecular formula C14H17ClN4O5S and a molecular weight of 388.83 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 131930236 |
| Molecular Formula | C14H17ClN4O5S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)NC1=O)NCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN4O5S/c15-9-1-3-10(4-2-9)25(23,24)17-8-7-16-12(20)6-5-11-13(21)19-14(22)18-11/h1-4,11,17H,5-8H2,(H,16,20)(H2,18,19,21,22)/t11-/m0/s1 |
| InChIKey | KRAQHXPFIKSCTM-NSHDSACASA-N |
| XLogP | -0.28 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|