C14H17N3O3S — CID 39969885
3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 39969885) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 39969885 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)NC1=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C14H17N3O3S/c18-12(7-6-11-13(19)17-14(20)16-11)15-8-9-21-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,18)(H2,16,17,19,20)/t11-/m0/s1 |
| InChIKey | WROCUJNHVUVART-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|