C13H17N3O4 — CID 70720397
3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-methylfuran-2-yl)ethyl]propanamide (PubChem CID 70720397) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-methylfuran-2-yl)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-methylfuran-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 70720397 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[2-(5-methylfuran-2-yl)ethyl]propanamide |
| SMILES | Cc1ccc(CCNC(=O)CCC2NC(=O)NC2=O)o1 |
| InChI | InChI=1S/C13H17N3O4/c1-8-2-3-9(20-8)6-7-14-11(17)5-4-10-12(18)16-13(19)15-10/h2-3,10H,4-7H2,1H3,(H,14,17)(H2,15,16,18,19) |
| InChIKey | MOPYJSIWOHOFNG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|