C10H15NO2 — CID 110872482
N-[2-(5-methylfuran-2-yl)ethyl]propanamide (PubChem CID 110872482) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[2-(5-methylfuran-2-yl)ethyl]propanamide.
| Compound Name | N-[2-(5-methylfuran-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110872482 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[2-(5-methylfuran-2-yl)ethyl]propanamide |
| SMILES | CCC(=O)NCCc1ccc(C)o1 |
| InChI | InChI=1S/C10H15NO2/c1-3-10(12)11-7-6-9-5-4-8(2)13-9/h4-5H,3,6-7H2,1-2H3,(H,11,12) |
| InChIKey | YZWCLYJFRXNGAY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |