C13H19NO4 — CID 115187971
methyl 2-[2-(5-methylfuran-2-yl)ethylcarbamoyl]butanoate (PubChem CID 115187971) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 2-[2-(5-methylfuran-2-yl)ethylcarbamoyl]butanoate.
| Compound Name | methyl 2-[2-(5-methylfuran-2-yl)ethylcarbamoyl]butanoate |
|---|---|
| PubChem CID | 115187971 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl 2-[2-(5-methylfuran-2-yl)ethylcarbamoyl]butanoate |
| SMILES | CCC(C(=O)NCCc1ccc(C)o1)C(=O)OC |
| InChI | InChI=1S/C13H19NO4/c1-4-11(13(16)17-3)12(15)14-8-7-10-6-5-9(2)18-10/h5-6,11H,4,7-8H2,1-3H3,(H,14,15) |
| InChIKey | PGYAKMWBYZOMEF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|