C18H26N4O4 — CID 70737130
3-(2,5-dioxoimidazolidin-4-yl)-N-[[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]methyl]propanamide (PubChem CID 70737130) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 70737130 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]methyl]propanamide |
| SMILES | Cc1ccc(CN2CCC(CNC(=O)CCC3NC(=O)NC3=O)CC2)o1 |
| InChI | InChI=1S/C18H26N4O4/c1-12-2-3-14(26-12)11-22-8-6-13(7-9-22)10-19-16(23)5-4-15-17(24)21-18(25)20-15/h2-3,13,15H,4-11H2,1H3,(H,19,23)(H2,20,21,24,25) |
| InChIKey | YJHWEEAAKODBRL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|