C21H28N2O3 — CID 42213549
3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-phenylpropanamide (PubChem CID 42213549) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 42213549 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-phenylpropanamide |
| SMILES | COCc1ccc(CN2CCC(CCC(=O)Nc3ccccc3)CC2)o1 |
| InChI | InChI=1S/C21H28N2O3/c1-25-16-20-9-8-19(26-20)15-23-13-11-17(12-14-23)7-10-21(24)22-18-5-3-2-4-6-18/h2-6,8-9,17H,7,10-16H2,1H3,(H,22,24) |
| InChIKey | ZGYLHNAJRQGFKP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |