C22H30N2O4 — CID 26405274
3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-(3-methoxyphenyl)propanamide (PubChem CID 26405274) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-(3-methoxyphenyl)propanamide.
| Compound Name | 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 26405274 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3-[1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidin-4-yl]-N-(3-methoxyphenyl)propanamide |
| SMILES | COCc1ccc(CN2CCC(CCC(=O)Nc3cccc(OC)c3)CC2)o1 |
| InChI | InChI=1S/C22H30N2O4/c1-26-16-21-8-7-20(28-21)15-24-12-10-17(11-13-24)6-9-22(25)23-18-4-3-5-19(14-18)27-2/h3-5,7-8,14,17H,6,9-13,15-16H2,1-2H3,(H,23,25) |
| InChIKey | LWCHMJWMKJEOCM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |