C12H15N3O3S — CID 110722163
N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 110722163) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110722163 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CCc1cccs1)NCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C12H15N3O3S/c16-10(4-3-8-2-1-7-19-8)13-6-5-9-11(17)15-12(18)14-9/h1-2,7,9H,3-6H2,(H,13,16)(H2,14,15,17,18) |
| InChIKey | XDZCYRSGSWTENN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|