C10H11N3O3S — CID 110722106
N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]thiophene-2-carboxamide (PubChem CID 110722106) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110722106 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C1NC(=O)C(CCNC(=O)c2cccs2)N1 |
| InChI | InChI=1S/C10H11N3O3S/c14-8-6(12-10(16)13-8)3-4-11-9(15)7-2-1-5-17-7/h1-2,5-6H,3-4H2,(H,11,15)(H2,12,13,14,16) |
| InChIKey | NCGQBHNVHPNLBA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|