C13H15N3O4 — CID 110722120
N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-methoxybenzamide (PubChem CID 110722120) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 110722120 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCC2NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C13H15N3O4/c1-20-9-4-2-3-8(7-9)11(17)14-6-5-10-12(18)16-13(19)15-10/h2-4,7,10H,5-6H2,1H3,(H,14,17)(H2,15,16,18,19) |
| InChIKey | MUOJUCNZEZQXGV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|