C20H20ClN3O5S — CID 108574022
N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 108574022) has the molecular formula C20H20ClN3O5S and a molecular weight of 449.92 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 108574022 |
| Molecular Formula | C20H20ClN3O5S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O5S/c21-14-7-9-15(10-8-14)30(28,29)23-12-11-22-18(25)6-3-13-24-19(26)16-4-1-2-5-17(16)20(24)27/h1-2,4-5,7-10,23H,3,6,11-13H2,(H,22,25) |
| InChIKey | BEZQFABPRGESHO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|