C15H19N3O5S — CID 108572140
3-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylsulfonylamino)ethyl]propanamide (PubChem CID 108572140) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylsulfonylamino)ethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylsulfonylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 108572140 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(ethylsulfonylamino)ethyl]propanamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19N3O5S/c1-2-24(22,23)17-9-8-16-13(19)7-10-18-14(20)11-5-3-4-6-12(11)15(18)21/h3-6,17H,2,7-10H2,1H3,(H,16,19) |
| InChIKey | OBPBDPUEWLODIH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|