C16H21N3O5S — CID 46480407
3-(1,3-dioxoisoindol-2-yl)-N-[3-[methyl(methylsulfonyl)amino]propyl]propanamide (PubChem CID 46480407) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[3-[methyl(methylsulfonyl)amino]propyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[methyl(methylsulfonyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 46480407 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[methyl(methylsulfonyl)amino]propyl]propanamide |
| SMILES | CN(CCCNC(=O)CCN1C(=O)c2ccccc2C1=O)S(C)(=O)=O |
| InChI | InChI=1S/C16H21N3O5S/c1-18(25(2,23)24)10-5-9-17-14(20)8-11-19-15(21)12-6-3-4-7-13(12)16(19)22/h3-4,6-7H,5,8-11H2,1-2H3,(H,17,20) |
| InChIKey | WGDKGMGJPWOBAR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|