C22H24BrN3O3 — CID 41306817
N-[3-[benzyl(methyl)amino]propyl]-3-(5-bromo-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 41306817) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-(5-bromo-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-(5-bromo-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 41306817 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-(5-bromo-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CN(CCCNC(=O)CCN1C(=O)c2ccc(Br)cc2C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H24BrN3O3/c1-25(15-16-6-3-2-4-7-16)12-5-11-24-20(27)10-13-26-21(28)18-9-8-17(23)14-19(18)22(26)29/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,24,27) |
| InChIKey | TYTNEGIWEWPCMO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|