C20H19BrN2O4 — CID 78855130
N-benzyl-3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-hydroxyethyl)propanamide (PubChem CID 78855130) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is N-benzyl-3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-hydroxyethyl)propanamide.
| Compound Name | N-benzyl-3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 78855130 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-benzyl-3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-hydroxyethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C20H19BrN2O4/c21-15-6-7-16-17(12-15)20(27)23(19(16)26)9-8-18(25)22(10-11-24)13-14-4-2-1-3-5-14/h1-7,12,24H,8-11,13H2 |
| InChIKey | AJVOSOMFILJKHA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|