C25H22BrN3O3 — CID 55982842
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 55982842) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55982842 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | Cc1ccccc1CN(Cc1cccnc1)C(=O)CCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C25H22BrN3O3/c1-17-5-2-3-7-19(17)16-28(15-18-6-4-11-27-14-18)23(30)10-12-29-24(31)21-9-8-20(26)13-22(21)25(29)32/h2-9,11,13-14H,10,12,15-16H2,1H3 |
| InChIKey | SOXTXHJNYQTLOA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|