C25H24N4O3 — CID 78803544
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 78803544) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 78803544 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)N(Cc1ccncc1)Cc1cccnc1)C2=O |
| InChI | InChI=1S/C25H24N4O3/c1-18-6-7-21-22(14-18)25(32)29(24(21)31)13-3-5-23(30)28(16-19-8-11-26-12-9-19)17-20-4-2-10-27-15-20/h2,4,6-12,14-15H,3,5,13,16-17H2,1H3 |
| InChIKey | KOBPOVNDDKXUPH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|