C23H24BrN3O4 — CID 55900147
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 55900147) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 55900147 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)N(Cc1cccnc1)CC1CCCO1 |
| InChI | InChI=1S/C23H24BrN3O4/c24-17-7-8-19-20(12-17)23(30)27(22(19)29)10-2-6-21(28)26(15-18-5-3-11-31-18)14-16-4-1-9-25-13-16/h1,4,7-9,12-13,18H,2-3,5-6,10-11,14-15H2 |
| InChIKey | NRTJYGQZNWRVGK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|