C21H22N2O4S — CID 9194353
3-(1,3-dioxoisoindol-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 9194353) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 9194353 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N(Cc1cccs1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H22N2O4S/c24-19(9-10-23-20(25)17-7-1-2-8-18(17)21(23)26)22(13-15-5-3-11-27-15)14-16-6-4-12-28-16/h1-2,4,6-8,12,15H,3,5,9-11,13-14H2/t15-/m1/s1 |
| InChIKey | ICADAHQTOMVVHU-OAHLLOKOSA-N |
| XLogP | 2.94 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|